C13H6ClNO3S2 — CID 4896042
5-[(8-chloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4896042) has the molecular formula C13H6ClNO3S2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 5-[(8-chloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(8-chloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4896042 |
| Molecular Formula | C13H6ClNO3S2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 5-[(8-chloro-4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1coc2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C13H6ClNO3S2/c14-8-3-1-2-7-10(16)6(5-18-11(7)8)4-9-12(17)15-13(19)20-9/h1-5H,(H,15,17,19) |
| InChIKey | IJHCWXHMMQMFMH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|