C13H7N3O2S4 — CID 54603528
(5E)-5-[[6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 54603528) has the molecular formula C13H7N3O2S4 and a molecular weight of 365.49 g/mol. Its IUPAC name is (5E)-5-[[6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 54603528 |
| Molecular Formula | C13H7N3O2S4 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | (5E)-5-[[6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/c1cccc(/C=C2/SC(=S)NC2=O)n1 |
| InChI | InChI=1S/C13H7N3O2S4/c17-10-8(21-12(19)15-10)4-6-2-1-3-7(14-6)5-9-11(18)16-13(20)22-9/h1-5H,(H,15,17,19)(H,16,18,20)/b8-4+,9-5+ |
| InChIKey | BKWWGKWHUDMLCM-KBXRYBNXSA-N |
| XLogP | 2.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|