C19H13N3O2S2 — CID 91313295
5-[[6-(4-methyl-2-oxo-1H-quinolin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 91313295) has the molecular formula C19H13N3O2S2 and a molecular weight of 379.47 g/mol. Its IUPAC name is 5-[[6-(4-methyl-2-oxo-1H-quinolin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[6-(4-methyl-2-oxo-1H-quinolin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91313295 |
| Molecular Formula | C19H13N3O2S2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 5-[[6-(4-methyl-2-oxo-1H-quinolin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(-c2cccc(C=C3SC(=S)NC3=O)n2)c(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H13N3O2S2/c1-10-12-6-2-3-7-13(12)21-18(24)16(10)14-8-4-5-11(20-14)9-15-17(23)22-19(25)26-15/h2-9H,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | YLMGXUIRYWTQJJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|