C17H10N4OS2 — CID 58642480
(5Z)-5-[[6-(1,7-naphthyridin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58642480) has the molecular formula C17H10N4OS2 and a molecular weight of 350.43 g/mol. Its IUPAC name is (5Z)-5-[[6-(1,7-naphthyridin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[6-(1,7-naphthyridin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58642480 |
| Molecular Formula | C17H10N4OS2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (5Z)-5-[[6-(1,7-naphthyridin-3-yl)-2-pyridinyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cccc(-c2cnc3cnccc3c2)n1 |
| InChI | InChI=1S/C17H10N4OS2/c22-16-15(24-17(23)21-16)7-12-2-1-3-13(20-12)11-6-10-4-5-18-9-14(10)19-8-11/h1-9H,(H,21,22,23)/b15-7- |
| InChIKey | KDQSBVNIGZFQSF-CHHVJCJISA-N |
| XLogP | 3.18 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|