C28H30N4O3 — CID 4898008
ethyl 1-[[3-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]indol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 4898008) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is ethyl 1-[[3-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]indol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]indol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4898008 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl 1-[[3-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]indol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2cc(C=C3C(=O)N(c4ccccc4)N=C3C)c3ccccc32)CC1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-35-28(34)21-13-15-30(16-14-21)19-31-18-22(24-11-7-8-12-26(24)31)17-25-20(2)29-32(27(25)33)23-9-5-4-6-10-23/h4-12,17-18,21H,3,13-16,19H2,1-2H3 |
| InChIKey | KJYLWEXRUZEAIR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|