C25H29N5O+2 — CID 7316320
(4E)-5-methyl-4-[[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 7316320) has the molecular formula C25H29N5O+2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (4E)-5-methyl-4-[[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4E)-5-methyl-4-[[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 7316320 |
| Molecular Formula | C25H29N5O+2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (4E)-5-methyl-4-[[1-[(4-methylpiperazine-1,4-diium-1-yl)methyl]indol-3-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C/c1cn(C[NH+]2CC[NH+](C)CC2)c2ccccc12 |
| InChI | InChI=1S/C25H27N5O/c1-19-23(25(31)30(26-19)21-8-4-3-5-9-21)16-20-17-29(24-11-7-6-10-22(20)24)18-28-14-12-27(2)13-15-28/h3-11,16-17H,12-15,18H2,1-2H3/p+2/b23-16+ |
| InChIKey | DGWVQSXPOCYLMR-XQNSMLJCSA-P |
| XLogP | 0.82 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|