C29H34FN5O3 — CID 127053181
(4E)-2-(4-fluorophenyl)-4-[[1-[(2S)-2-hydroxy-3-(3-morpholin-4-ylpropylamino)propyl]indol-3-yl]methylidene]-5-methylpyrazol-3-one (PubChem CID 127053181) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is (4E)-2-(4-fluorophenyl)-4-[[1-[(2S)-2-hydroxy-3-(3-morpholin-4-ylpropylamino)propyl]indol-3-yl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(4-fluorophenyl)-4-[[1-[(2S)-2-hydroxy-3-(3-morpholin-4-ylpropylamino)propyl]indol-3-yl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 127053181 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (4E)-2-(4-fluorophenyl)-4-[[1-[(2S)-2-hydroxy-3-(3-morpholin-4-ylpropylamino)propyl]indol-3-yl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2ccc(F)cc2)C(=O)/C1=C/c1cn(C[C@@H](O)CNCCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C29H34FN5O3/c1-21-27(29(37)35(32-21)24-9-7-23(30)8-10-24)17-22-19-34(28-6-3-2-5-26(22)28)20-25(36)18-31-11-4-12-33-13-15-38-16-14-33/h2-3,5-10,17,19,25,31,36H,4,11-16,18,20H2,1H3/b27-17+/t25-/m0/s1 |
| InChIKey | KRTPZCZIQPMZFF-YYYGAUAXSA-N |
| XLogP | 3.26 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|