C16H25N3O2S — CID 4900413
8-morpholin-4-yl-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 4900413) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 8-morpholin-4-yl-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
| Compound Name | 8-morpholin-4-yl-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
|---|---|
| PubChem CID | 4900413 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 8-morpholin-4-yl-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | CCCCCc1c(N2CCOCC2)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-3-4-6-13-14(18-8-10-21-11-9-18)17-16-19(15(13)20)7-5-12-22-16/h2-12H2,1H3 |
| InChIKey | CMMGEFONUCMDQY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|