C23H21N5O3S — CID 4901687
2-[3-(14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)propyl]isoindole-1,3-dione (PubChem CID 4901687) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-[3-(14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4901687 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[3-(14,14-dimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)propyl]isoindole-1,3-dione |
| SMILES | CC1(C)Cc2c(sc3ncn4nc(CCCN5C(=O)c6ccccc6C5=O)nc4c23)CO1 |
| InChI | InChI=1S/C23H21N5O3S/c1-23(2)10-15-16(11-31-23)32-20-18(15)19-25-17(26-28(19)12-24-20)8-5-9-27-21(29)13-6-3-4-7-14(13)22(27)30/h3-4,6-7,12H,5,8-11H2,1-2H3 |
| InChIKey | SLNFARSJBNXNIV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|