C23H32N2O2S — CID 49056073
4-(2-phenylethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide (PubChem CID 49056073) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 4-(2-phenylethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide.
| Compound Name | 4-(2-phenylethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 49056073 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-(2-phenylethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide |
| SMILES | O=C(CCCOCCc1ccccc1)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H32N2O2S/c26-23(9-4-15-27-16-12-20-6-2-1-3-7-20)24-18-21-10-13-25(14-11-21)19-22-8-5-17-28-22/h1-3,5-8,17,21H,4,9-16,18-19H2,(H,24,26) |
| InChIKey | SSIFXEFZXHHQDQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|