C23H18ClF3N2O3 — CID 4906941
4-benzoyl-2-[2-chloro-5-(trifluoromethyl)phenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 4906941) has the molecular formula C23H18ClF3N2O3 and a molecular weight of 462.86 g/mol. Its IUPAC name is 4-benzoyl-2-[2-chloro-5-(trifluoromethyl)phenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | 4-benzoyl-2-[2-chloro-5-(trifluoromethyl)phenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 4906941 |
| Molecular Formula | C23H18ClF3N2O3 |
| Molecular Weight | 462.86 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-benzoyl-2-[2-chloro-5-(trifluoromethyl)phenyl]-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | O=C(c1ccccc1)C1C2C(=O)N(c3cc(C(F)(F)F)ccc3Cl)C(=O)C2C2CCCN21 |
| InChI | InChI=1S/C23H18ClF3N2O3/c24-14-9-8-13(23(25,26)27)11-16(14)29-21(31)17-15-7-4-10-28(15)19(18(17)22(29)32)20(30)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,15,17-19H,4,7,10H2 |
| InChIKey | LUNBNVJKDRBLKW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|