C15H21F2N3O3S — CID 49074013
N-[1-(2,2-difluoroethyl)piperidin-4-yl]-4-(methylsulfamoyl)benzamide (PubChem CID 49074013) has the molecular formula C15H21F2N3O3S and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)piperidin-4-yl]-4-(methylsulfamoyl)benzamide.
| Compound Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 49074013 |
| Molecular Formula | C15H21F2N3O3S |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC2CCN(CC(F)F)CC2)cc1 |
| InChI | InChI=1S/C15H21F2N3O3S/c1-18-24(22,23)13-4-2-11(3-5-13)15(21)19-12-6-8-20(9-7-12)10-14(16)17/h2-5,12,14,18H,6-10H2,1H3,(H,19,21) |
| InChIKey | RHJXMKZABLAFDY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |