C22H25N3O2S — CID 49089233
2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide (PubChem CID 49089233) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 49089233 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H25N3O2S/c1-15-20(18-6-2-3-7-19(18)24-15)21(26)22(27)23-13-16-8-10-25(11-9-16)14-17-5-4-12-28-17/h2-7,12,16,24H,8-11,13-14H2,1H3,(H,23,27) |
| InChIKey | KQNWWJLJPVZUDY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|