C17H17F3N2O5S — CID 49089748
N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(methanesulfonamido)benzamide (PubChem CID 49089748) has the molecular formula C17H17F3N2O5S and a molecular weight of 418.39 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 49089748 |
| Molecular Formula | C17H17F3N2O5S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)NCC(O)c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H17F3N2O5S/c1-28(25,26)22-13-4-2-3-12(9-13)16(24)21-10-15(23)11-5-7-14(8-6-11)27-17(18,19)20/h2-9,15,22-23H,10H2,1H3,(H,21,24) |
| InChIKey | ALOYTIFPGPOATR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |