C17H20N2O4S2 — CID 4910119
N-(3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)oxolane-2-carboxamide (PubChem CID 4910119) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)oxolane-2-carboxamide.
| Compound Name | N-(3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4910119 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(3-benzyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)oxolane-2-carboxamide |
| SMILES | O=C(/N=C1\SC2CS(=O)(=O)CC2N1Cc1ccccc1)C1CCCO1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-16(14-7-4-8-23-14)18-17-19(9-12-5-2-1-3-6-12)13-10-25(21,22)11-15(13)24-17/h1-3,5-6,13-15H,4,7-11H2/b18-17- |
| InChIKey | SWRRXOYPTYMFNT-ZCXUNETKSA-N |
| XLogP | 1.46 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|