C18H22N2O5S2 — CID 98655082
(2R)-N-[(3aS,6aS)-3-[(2-methoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide (PubChem CID 98655082) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2R)-N-[(3aS,6aS)-3-[(2-methoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[(3aS,6aS)-3-[(2-methoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 98655082 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2R)-N-[(3aS,6aS)-3-[(2-methoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]oxolane-2-carboxamide |
| SMILES | COc1ccccc1CN1/C(=N/C(=O)[C@H]2CCCO2)S[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H22N2O5S2/c1-24-14-6-3-2-5-12(14)9-20-13-10-27(22,23)11-16(13)26-18(20)19-17(21)15-7-4-8-25-15/h2-3,5-6,13,15-16H,4,7-11H2,1H3/b19-18-/t13-,15+,16+/m0/s1 |
| InChIKey | ZSULWWHMVPAASQ-XTYLXKIBSA-N |
| XLogP | 1.47 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|