C19H25N3O5 — CID 49107650
[2-oxo-2-[(2-oxoazepan-3-yl)amino]ethyl] 2-morpholin-4-ylbenzoate (PubChem CID 49107650) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-oxo-2-[(2-oxoazepan-3-yl)amino]ethyl] 2-morpholin-4-ylbenzoate.
| Compound Name | [2-oxo-2-[(2-oxoazepan-3-yl)amino]ethyl] 2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 49107650 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [2-oxo-2-[(2-oxoazepan-3-yl)amino]ethyl] 2-morpholin-4-ylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1CCOCC1)NC1CCCCNC1=O |
| InChI | InChI=1S/C19H25N3O5/c23-17(21-15-6-3-4-8-20-18(15)24)13-27-19(25)14-5-1-2-7-16(14)22-9-11-26-12-10-22/h1-2,5,7,15H,3-4,6,8-13H2,(H,20,24)(H,21,23) |
| InChIKey | QAAMSMDWQMEQME-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |