C26H20N4O2 — CID 4911103
14-ethyl-11-(4-methoxyphenyl)-3,10,12,14-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one (PubChem CID 4911103) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 14-ethyl-11-(4-methoxyphenyl)-3,10,12,14-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one.
| Compound Name | 14-ethyl-11-(4-methoxyphenyl)-3,10,12,14-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one |
|---|---|
| PubChem CID | 4911103 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 14-ethyl-11-(4-methoxyphenyl)-3,10,12,14-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one |
| SMILES | CCn1c2ccccc2c(=O)c2c1nc(-c1ccc(OC)cc1)n1c3ccccc3nc21 |
| InChI | InChI=1S/C26H20N4O2/c1-3-29-20-10-6-4-8-18(20)23(31)22-25(29)28-24(16-12-14-17(32-2)15-13-16)30-21-11-7-5-9-19(21)27-26(22)30/h4-15H,3H2,1-2H3 |
| InChIKey | LVXHDLYEQNPSRV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|