C26H19N3O4S — CID 4908771
11-(3,4,5-trimethoxyphenyl)-14-thia-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one (PubChem CID 4908771) has the molecular formula C26H19N3O4S and a molecular weight of 469.52 g/mol. Its IUPAC name is 11-(3,4,5-trimethoxyphenyl)-14-thia-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one.
| Compound Name | 11-(3,4,5-trimethoxyphenyl)-14-thia-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one |
|---|---|
| PubChem CID | 4908771 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 11-(3,4,5-trimethoxyphenyl)-14-thia-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaen-21-one |
| SMILES | COc1cc(-c2nc3sc4ccccc4c(=O)c3c3nc4ccccc4n23)cc(OC)c1OC |
| InChI | InChI=1S/C26H19N3O4S/c1-31-18-12-14(13-19(32-2)23(18)33-3)24-28-26-21(22(30)15-8-4-7-11-20(15)34-26)25-27-16-9-5-6-10-17(16)29(24)25/h4-13H,1-3H3 |
| InChIKey | BIKVMRUGFKOXJF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|