C11H21NO — CID 4912825
1,2,5-trimethyl-4-prop-2-enylpiperidin-4-ol (PubChem CID 4912825) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1,2,5-trimethyl-4-prop-2-enylpiperidin-4-ol.
| Compound Name | 1,2,5-trimethyl-4-prop-2-enylpiperidin-4-ol |
|---|---|
| PubChem CID | 4912825 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1,2,5-trimethyl-4-prop-2-enylpiperidin-4-ol |
| SMILES | C=CCC1(O)CC(C)N(C)CC1C |
| InChI | InChI=1S/C11H21NO/c1-5-6-11(13)7-10(3)12(4)8-9(11)2/h5,9-10,13H,1,6-8H2,2-4H3 |
| InChIKey | HAYJMKCUHUHZDC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|