C18H18N2O2S2 — CID 49153749
N-[2-(cyanomethylsulfanyl)phenyl]-2-[(3-methoxyphenyl)methylsulfanyl]acetamide (PubChem CID 49153749) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[(3-methoxyphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(3-methoxyphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 49153749 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(3-methoxyphenyl)methylsulfanyl]acetamide |
| SMILES | COc1cccc(CSCC(=O)Nc2ccccc2SCC#N)c1 |
| InChI | InChI=1S/C18H18N2O2S2/c1-22-15-6-4-5-14(11-15)12-23-13-18(21)20-16-7-2-3-8-17(16)24-10-9-19/h2-8,11H,10,12-13H2,1H3,(H,20,21) |
| InChIKey | VEJHKZKBWWJSES-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |