C23H26N2O7 — CID 4917975
N-[2-(1-adamantyloxy)ethyl]-8-methoxy-6-nitro-2-oxochromene-3-carboxamide (PubChem CID 4917975) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-[2-(1-adamantyloxy)ethyl]-8-methoxy-6-nitro-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(1-adamantyloxy)ethyl]-8-methoxy-6-nitro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4917975 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[2-(1-adamantyloxy)ethyl]-8-methoxy-6-nitro-2-oxochromene-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)NCCOC34CC5CC(CC(C5)C3)C4)c(=O)oc12 |
| InChI | InChI=1S/C23H26N2O7/c1-30-19-9-17(25(28)29)7-16-8-18(22(27)32-20(16)19)21(26)24-2-3-31-23-10-13-4-14(11-23)6-15(5-13)12-23/h7-9,13-15H,2-6,10-12H2,1H3,(H,24,26) |
| InChIKey | MGAUIWYLWMILQS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|