C18H20N2O6 — CID 1244415
8-methoxy-N-[(1S,2R)-2-methylcyclohexyl]-6-nitro-2-oxochromene-3-carboxamide (PubChem CID 1244415) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 8-methoxy-N-[(1S,2R)-2-methylcyclohexyl]-6-nitro-2-oxochromene-3-carboxamide.
| Compound Name | 8-methoxy-N-[(1S,2R)-2-methylcyclohexyl]-6-nitro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1244415 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 8-methoxy-N-[(1S,2R)-2-methylcyclohexyl]-6-nitro-2-oxochromene-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)N[C@H]3CCCC[C@H]3C)c(=O)oc12 |
| InChI | InChI=1S/C18H20N2O6/c1-10-5-3-4-6-14(10)19-17(21)13-8-11-7-12(20(23)24)9-15(25-2)16(11)26-18(13)22/h7-10,14H,3-6H2,1-2H3,(H,19,21)/t10-,14+/m1/s1 |
| InChIKey | RBSPWTMPPNTTTJ-YGRLFVJLSA-N |
| XLogP | 3.02 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|