C24H21ClN2O4S2 — CID 4918844
2-chloro-5-methylsulfanyl-N-(8-pyrrolidin-1-ylsulfonyldibenzofuran-3-yl)benzamide (PubChem CID 4918844) has the molecular formula C24H21ClN2O4S2 and a molecular weight of 501.03 g/mol. Its IUPAC name is 2-chloro-5-methylsulfanyl-N-(8-pyrrolidin-1-ylsulfonyldibenzofuran-3-yl)benzamide.
| Compound Name | 2-chloro-5-methylsulfanyl-N-(8-pyrrolidin-1-ylsulfonyldibenzofuran-3-yl)benzamide |
|---|---|
| PubChem CID | 4918844 |
| Molecular Formula | C24H21ClN2O4S2 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 2-chloro-5-methylsulfanyl-N-(8-pyrrolidin-1-ylsulfonyldibenzofuran-3-yl)benzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)Nc2ccc3c(c2)oc2ccc(S(=O)(=O)N4CCCC4)cc23)c1 |
| InChI | InChI=1S/C24H21ClN2O4S2/c1-32-16-5-8-21(25)20(13-16)24(28)26-15-4-7-18-19-14-17(6-9-22(19)31-23(18)12-15)33(29,30)27-10-2-3-11-27/h4-9,12-14H,2-3,10-11H2,1H3,(H,26,28) |
| InChIKey | UOYXKEPUZIHZIQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |