C17H14N4O2S — CID 49201042
N'-[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]quinoline-8-carbohydrazide (PubChem CID 49201042) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N'-[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]quinoline-8-carbohydrazide.
| Compound Name | N'-[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 49201042 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N'-[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]quinoline-8-carbohydrazide |
| SMILES | Cc1nc(/C=C/C(=O)NNC(=O)c2cccc3cccnc23)cs1 |
| InChI | InChI=1S/C17H14N4O2S/c1-11-19-13(10-24-11)7-8-15(22)20-21-17(23)14-6-2-4-12-5-3-9-18-16(12)14/h2-10H,1H3,(H,20,22)(H,21,23)/b8-7+ |
| InChIKey | OZVDQJYBAWXWRM-BQYQJAHWSA-N |
| XLogP | 2.47 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|