C22H28N4OS — CID 49215203
2-(2-ethylbenzimidazol-1-yl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide (PubChem CID 49215203) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-(2-ethylbenzimidazol-1-yl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | 2-(2-ethylbenzimidazol-1-yl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 49215203 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-(2-ethylbenzimidazol-1-yl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CCc1nc2ccccc2n1CC(=O)NCC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C22H28N4OS/c1-2-21-24-19-9-3-4-10-20(19)26(21)16-22(27)23-13-17-7-5-11-25(14-17)15-18-8-6-12-28-18/h3-4,6,8-10,12,17H,2,5,7,11,13-16H2,1H3,(H,23,27) |
| InChIKey | DZADNJBCBURCQN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |