C18H17ClN4O3 — CID 49333169
1-(2-chlorophenyl)-N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrazole-3-carboxamide (PubChem CID 49333169) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49333169 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrazole-3-carboxamide |
| SMILES | CC(NC(=O)c1ccn(-c2ccccc2Cl)n1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H17ClN4O3/c1-12(17(24)20-11-13-5-4-10-26-13)21-18(25)15-8-9-23(22-15)16-7-3-2-6-14(16)19/h2-10,12H,11H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | DTAYMFRYJZEPRI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |