C18H19ClN4OS — CID 49372359
1-(2-chlorophenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]pyrazole-3-carboxamide (PubChem CID 49372359) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49372359 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]pyrazole-3-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1ccn(-c2ccccc2Cl)n1)c1cccs1 |
| InChI | InChI=1S/C18H19ClN4OS/c1-22(2)16(17-8-5-11-25-17)12-20-18(24)14-9-10-23(21-14)15-7-4-3-6-13(15)19/h3-11,16H,12H2,1-2H3,(H,20,24) |
| InChIKey | VSQJUYQMUPXMBL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |