C22H30N4O3 — CID 49407769
N-butyl-1-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 49407769) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-butyl-1-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-butyl-1-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49407769 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-butyl-1-(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(C(=O)c2nn(C(C)C)c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-5-12-23-20(27)16-9-8-13-25(14-16)22(29)19-17-10-6-7-11-18(17)21(28)26(24-19)15(2)3/h6-7,10-11,15-16H,4-5,8-9,12-14H2,1-3H3,(H,23,27) |
| InChIKey | NMBRJUVJZXUCDT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|