C18H18FN3O3 — CID 49408271
N-[1-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 49408271) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is N-[1-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]furan-3-carboxamide.
| Compound Name | N-[1-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 49408271 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[1-[2-(6-fluoro-1H-indol-3-yl)ethylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H18FN3O3/c1-11(22-18(24)13-5-7-25-10-13)17(23)20-6-4-12-9-21-16-8-14(19)2-3-15(12)16/h2-3,5,7-11,21H,4,6H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | MUOLIASXQPNSQT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |