C28H31N3O3S — CID 4947172
N-benzyl-2-[methyl-[(2-pentoxybenzoyl)carbamothioyl]amino]benzamide (PubChem CID 4947172) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-benzyl-2-[methyl-[(2-pentoxybenzoyl)carbamothioyl]amino]benzamide.
| Compound Name | N-benzyl-2-[methyl-[(2-pentoxybenzoyl)carbamothioyl]amino]benzamide |
|---|---|
| PubChem CID | 4947172 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-benzyl-2-[methyl-[(2-pentoxybenzoyl)carbamothioyl]amino]benzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)N(C)c1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H31N3O3S/c1-3-4-12-19-34-25-18-11-9-16-23(25)27(33)30-28(35)31(2)24-17-10-8-15-22(24)26(32)29-20-21-13-6-5-7-14-21/h5-11,13-18H,3-4,12,19-20H2,1-2H3,(H,29,32)(H,30,33,35) |
| InChIKey | MBULEHHKGQFKGN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|