C24H22ClN3O2S — CID 4937030
N-benzyl-2-[[2-(4-chlorophenyl)acetyl]carbamothioyl-methylamino]benzamide (PubChem CID 4937030) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-chlorophenyl)acetyl]carbamothioyl-methylamino]benzamide.
| Compound Name | N-benzyl-2-[[2-(4-chlorophenyl)acetyl]carbamothioyl-methylamino]benzamide |
|---|---|
| PubChem CID | 4937030 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-benzyl-2-[[2-(4-chlorophenyl)acetyl]carbamothioyl-methylamino]benzamide |
| SMILES | CN(C(=S)NC(=O)Cc1ccc(Cl)cc1)c1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O2S/c1-28(24(31)27-22(29)15-17-11-13-19(25)14-12-17)21-10-6-5-9-20(21)23(30)26-16-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H,26,30)(H,27,29,31) |
| InChIKey | FPLLCMJJZZKQHW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|