C24H21Cl2N3O2S — CID 4930697
2,4-dichloro-N-[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4930697) has the molecular formula C24H21Cl2N3O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2,4-dichloro-N-[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4930697 |
| Molecular Formula | C24H21Cl2N3O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2,4-dichloro-N-[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc(Cl)cc1Cl)c1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C24H21Cl2N3O2S/c1-29(24(32)28-23(31)18-12-11-17(25)15-20(18)26)21-10-6-5-9-19(21)22(30)27-14-13-16-7-3-2-4-8-16/h2-12,15H,13-14H2,1H3,(H,27,30)(H,28,31,32) |
| InChIKey | MTXBWJBLSDMRAK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|