C27H27N3O2S — CID 6233706
2-[methyl-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 6233706) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 2-[methyl-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[methyl-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 6233706 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[methyl-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(=S)N(C)c2ccccc2C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O2S/c1-20-12-14-22(15-13-20)16-17-25(31)29-27(33)30(2)24-11-7-6-10-23(24)26(32)28-19-18-21-8-4-3-5-9-21/h3-17H,18-19H2,1-2H3,(H,28,32)(H,29,31,33)/b17-16+ |
| InChIKey | WVFUEGYRCBRAIR-WUKNDPDISA-N |
| XLogP | 4.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|