C29H31N3O4S — CID 4947360
2-phenylethyl 4-[[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]amino]-4-oxobutanoate (PubChem CID 4947360) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is 2-phenylethyl 4-[[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]amino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947360 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-phenylethyl 4-[[methyl-[2-(2-phenylethylcarbamoyl)phenyl]carbamothioyl]amino]-4-oxobutanoate |
| SMILES | CN(C(=S)NC(=O)CCC(=O)OCCc1ccccc1)c1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C29H31N3O4S/c1-32(25-15-9-8-14-24(25)28(35)30-20-18-22-10-4-2-5-11-22)29(37)31-26(33)16-17-27(34)36-21-19-23-12-6-3-7-13-23/h2-15H,16-21H2,1H3,(H,30,35)(H,31,33,37) |
| InChIKey | WUNGBAIOIRETEX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|