C21H18BrClN2O3 — CID 55791780
5-bromo-N-[2-[2-(3-chlorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 55791780) has the molecular formula C21H18BrClN2O3 and a molecular weight of 461.74 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(3-chlorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(3-chlorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55791780 |
| Molecular Formula | C21H18BrClN2O3 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 5-bromo-N-[2-[2-(3-chlorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Br)o1)c1ccccc1C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H18BrClN2O3/c1-25(21(27)18-9-10-19(22)28-18)17-8-3-2-7-16(17)20(26)24-12-11-14-5-4-6-15(23)13-14/h2-10,13H,11-12H2,1H3,(H,24,26) |
| InChIKey | TYBODMOHIKKAIW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |