C21H18BrFN2O3 — CID 55791443
5-bromo-N-[2-[2-(2-fluorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 55791443) has the molecular formula C21H18BrFN2O3 and a molecular weight of 445.29 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(2-fluorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(2-fluorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55791443 |
| Molecular Formula | C21H18BrFN2O3 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 5-bromo-N-[2-[2-(2-fluorophenyl)ethylcarbamoyl]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Br)o1)c1ccccc1C(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C21H18BrFN2O3/c1-25(21(27)18-10-11-19(22)28-18)17-9-5-3-7-15(17)20(26)24-13-12-14-6-2-4-8-16(14)23/h2-11H,12-13H2,1H3,(H,24,26) |
| InChIKey | YBKDVQPKKIKEGN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |