C22H17BrN2O3 — CID 55929010
5-bromo-N-methyl-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 55929010) has the molecular formula C22H17BrN2O3 and a molecular weight of 437.29 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55929010 |
| Molecular Formula | C22H17BrN2O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-(3-phenylprop-2-ynylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Br)o1)c1ccccc1C(=O)NCC#Cc1ccccc1 |
| InChI | InChI=1S/C22H17BrN2O3/c1-25(22(27)19-13-14-20(23)28-19)18-12-6-5-11-17(18)21(26)24-15-7-10-16-8-3-2-4-9-16/h2-6,8-9,11-14H,15H2,1H3,(H,24,26) |
| InChIKey | XHZSSYXZIOTBCT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|