C23H19ClN4O4S — CID 4930929
N-[[2-(benzylcarbamoyl)phenyl]-methylcarbamothioyl]-4-chloro-3-nitrobenzamide (PubChem CID 4930929) has the molecular formula C23H19ClN4O4S and a molecular weight of 482.95 g/mol. Its IUPAC name is N-[[2-(benzylcarbamoyl)phenyl]-methylcarbamothioyl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[[2-(benzylcarbamoyl)phenyl]-methylcarbamothioyl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 4930929 |
| Molecular Formula | C23H19ClN4O4S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[[2-(benzylcarbamoyl)phenyl]-methylcarbamothioyl]-4-chloro-3-nitrobenzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H19ClN4O4S/c1-27(23(33)26-21(29)16-11-12-18(24)20(13-16)28(31)32)19-10-6-5-9-17(19)22(30)25-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,25,30)(H,26,29,33) |
| InChIKey | NBALEDOWTCKEHG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|