C15H27N3O3S — CID 49478413
1-(dicyclopropylmethyl)-1-methyl-3-(1-methylsulfonylpiperidin-3-yl)urea (PubChem CID 49478413) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-(dicyclopropylmethyl)-1-methyl-3-(1-methylsulfonylpiperidin-3-yl)urea.
| Compound Name | 1-(dicyclopropylmethyl)-1-methyl-3-(1-methylsulfonylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 49478413 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-(dicyclopropylmethyl)-1-methyl-3-(1-methylsulfonylpiperidin-3-yl)urea |
| SMILES | CN(C(=O)NC1CCCN(S(C)(=O)=O)C1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H27N3O3S/c1-17(14(11-5-6-11)12-7-8-12)15(19)16-13-4-3-9-18(10-13)22(2,20)21/h11-14H,3-10H2,1-2H3,(H,16,19) |
| InChIKey | TXECJUHEPFUEKD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |