C21H20ClN3O2S — CID 49494657
N-[3-[4-(benzylamino)-3-chloroanilino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 49494657) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is N-[3-[4-(benzylamino)-3-chloroanilino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[4-(benzylamino)-3-chloroanilino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 49494657 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[3-[4-(benzylamino)-3-chloroanilino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)Nc1ccc(NCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O2S/c22-18-12-17(6-7-19(18)24-13-15-4-2-1-3-5-15)25-20(26)8-10-23-21(27)16-9-11-28-14-16/h1-7,9,11-12,14,24H,8,10,13H2,(H,23,27)(H,25,26) |
| InChIKey | ZZGSCDCCDLLKPY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |