C17H16BrFN2O4 — CID 4955751
3-bromo-4-butoxy-N-(2-fluoro-5-nitrophenyl)benzamide (PubChem CID 4955751) has the molecular formula C17H16BrFN2O4 and a molecular weight of 411.23 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-(2-fluoro-5-nitrophenyl)benzamide.
| Compound Name | 3-bromo-4-butoxy-N-(2-fluoro-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 4955751 |
| Molecular Formula | C17H16BrFN2O4 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 3-bromo-4-butoxy-N-(2-fluoro-5-nitrophenyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc([N+](=O)[O-])ccc2F)cc1Br |
| InChI | InChI=1S/C17H16BrFN2O4/c1-2-3-8-25-16-7-4-11(9-13(16)18)17(22)20-15-10-12(21(23)24)5-6-14(15)19/h4-7,9-10H,2-3,8H2,1H3,(H,20,22) |
| InChIKey | MZYGCJNHSPNVRO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|