C21H28N2O3S — CID 4958608
N-[4-(benzylsulfamoyl)phenyl]octanamide (PubChem CID 4958608) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[4-(benzylsulfamoyl)phenyl]octanamide.
| Compound Name | N-[4-(benzylsulfamoyl)phenyl]octanamide |
|---|---|
| PubChem CID | 4958608 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[4-(benzylsulfamoyl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-2-3-4-5-9-12-21(24)23-19-13-15-20(16-14-19)27(25,26)22-17-18-10-7-6-8-11-18/h6-8,10-11,13-16,22H,2-5,9,12,17H2,1H3,(H,23,24) |
| InChIKey | ACGGCYKTCIIIIK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|