C12H16N4O3 — CID 4962670
4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol (PubChem CID 4962670) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol.
| Compound Name | 4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol |
|---|---|
| PubChem CID | 4962670 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol |
| SMILES | NCC(O)C(O)C(O)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H16N4O3/c13-6-10(17)12(19)11(18)9-7-14-16(15-9)8-4-2-1-3-5-8/h1-5,7,10-12,17-19H,6,13H2 |
| InChIKey | RFLWNLAGEPXFTL-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |