C12H15N3O4 — CID 7106948
(1R,2S,3R)-1-(2-phenyltriazol-4-yl)butane-1,2,3,4-tetrol (PubChem CID 7106948) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is (1R,2S,3R)-1-(2-phenyltriazol-4-yl)butane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R)-1-(2-phenyltriazol-4-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 7106948 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1R,2S,3R)-1-(2-phenyltriazol-4-yl)butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H15N3O4/c16-7-10(17)12(19)11(18)9-6-13-15(14-9)8-4-2-1-3-5-8/h1-6,10-12,16-19H,7H2/t10-,11-,12-/m1/s1 |
| InChIKey | JNMUJXXKLZFAIT-IJLUTSLNSA-N |
| XLogP | -0.99 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |