C12H14FN3O4 — CID 606076
1-[2-(2-fluorophenyl)triazol-4-yl]butane-1,2,3,4-tetrol (PubChem CID 606076) has the molecular formula C12H14FN3O4 and a molecular weight of 283.26 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)triazol-4-yl]butane-1,2,3,4-tetrol.
| Compound Name | 1-[2-(2-fluorophenyl)triazol-4-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 606076 |
| Molecular Formula | C12H14FN3O4 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)triazol-4-yl]butane-1,2,3,4-tetrol |
| SMILES | OCC(O)C(O)C(O)c1cnn(-c2ccccc2F)n1 |
| InChI | InChI=1S/C12H14FN3O4/c13-7-3-1-2-4-9(7)16-14-5-8(15-16)11(19)12(20)10(18)6-17/h1-5,10-12,17-20H,6H2 |
| InChIKey | GUACULBKHHAZAP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |