C23H29ClN2O3S2 — CID 4963605
1-(5-chlorothiophen-2-yl)sulfonyl-N-cycloheptyl-4-phenylpiperidine-4-carboxamide (PubChem CID 4963605) has the molecular formula C23H29ClN2O3S2 and a molecular weight of 481.08 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-cycloheptyl-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-cycloheptyl-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 4963605 |
| Molecular Formula | C23H29ClN2O3S2 |
| Molecular Weight | 481.08 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-cycloheptyl-4-phenylpiperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1(c2ccccc2)CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C23H29ClN2O3S2/c24-20-12-13-21(30-20)31(28,29)26-16-14-23(15-17-26,18-8-4-3-5-9-18)22(27)25-19-10-6-1-2-7-11-19/h3-5,8-9,12-13,19H,1-2,6-7,10-11,14-17H2,(H,25,27) |
| InChIKey | OFKIHZGHDVRQSX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.08 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |