C24H26N4O6S — CID 4964413
3-(acetamidomethylsulfanyl)-2-[[2-(1-methyl-2,4-dioxoquinazolin-3-yl)-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 4964413) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is 3-(acetamidomethylsulfanyl)-2-[[2-(1-methyl-2,4-dioxoquinazolin-3-yl)-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-(acetamidomethylsulfanyl)-2-[[2-(1-methyl-2,4-dioxoquinazolin-3-yl)-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 4964413 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-(acetamidomethylsulfanyl)-2-[[2-(1-methyl-2,4-dioxoquinazolin-3-yl)-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(=O)NCSCC(NC(=O)C(Cc1ccccc1)n1c(=O)c2ccccc2n(C)c1=O)C(=O)O |
| InChI | InChI=1S/C24H26N4O6S/c1-15(29)25-14-35-13-18(23(32)33)26-21(30)20(12-16-8-4-3-5-9-16)28-22(31)17-10-6-7-11-19(17)27(2)24(28)34/h3-11,18,20H,12-14H2,1-2H3,(H,25,29)(H,26,30)(H,32,33) |
| InChIKey | IXZHJKNPVJYURV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|