C18H20N4O3 — CID 4964733
N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 4964733) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 4964733 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COCCNC(=O)C(C)NC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H20N4O3/c1-11(17(23)19-7-8-25-2)21-18(24)15-9-13-12-5-3-4-6-14(12)22-16(13)10-20-15/h3-6,9-11,22H,7-8H2,1-2H3,(H,19,23)(H,21,24) |
| InChIKey | FPWLDXHRKUHKOR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|