C19H21N3O3 — CID 78302283
methyl 4-methyl-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)pentanoate (PubChem CID 78302283) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl 4-methyl-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)pentanoate.
| Compound Name | methyl 4-methyl-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 78302283 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 4-methyl-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C19H21N3O3/c1-11(2)8-16(19(24)25-3)22-18(23)15-9-13-12-6-4-5-7-14(12)21-17(13)10-20-15/h4-7,9-11,16,21H,8H2,1-3H3,(H,22,23) |
| InChIKey | CTOFLACLODXZBA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |